C26H31N5O2 — CID 146583110
8-(1-methylpiperidin-4-yl)-1-(1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde (PubChem CID 146583110) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 8-(1-methylpiperidin-4-yl)-1-(1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde.
| Compound Name | 8-(1-methylpiperidin-4-yl)-1-(1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde |
|---|---|
| PubChem CID | 146583110 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 8-(1-methylpiperidin-4-yl)-1-(1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-5H-pyrido[4,3-b]indole-4-carbaldehyde |
| SMILES | CN1CCC(c2ccc3[nH]c4c(C=O)cnc(N5CCCC6(CCNC6=O)C5)c4c3c2)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-30-11-5-17(6-12-30)18-3-4-21-20(13-18)22-23(29-21)19(15-32)14-28-24(22)31-10-2-7-26(16-31)8-9-27-25(26)33/h3-4,13-15,17,29H,2,5-12,16H2,1H3,(H,27,33) |
| InChIKey | LERPBLIGKNBJRL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|