C27H39N7O2 — CID 145166476
3-ethyl-1-[4-hydrazinyloxy-8-(1-propan-2-ylpiperidin-4-yl)-5H-pyrido[4,3-b]indol-1-yl]piperidine-3-carboxamide (PubChem CID 145166476) has the molecular formula C27H39N7O2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 3-ethyl-1-[4-hydrazinyloxy-8-(1-propan-2-ylpiperidin-4-yl)-5H-pyrido[4,3-b]indol-1-yl]piperidine-3-carboxamide.
| Compound Name | 3-ethyl-1-[4-hydrazinyloxy-8-(1-propan-2-ylpiperidin-4-yl)-5H-pyrido[4,3-b]indol-1-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 145166476 |
| Molecular Formula | C27H39N7O2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 3-ethyl-1-[4-hydrazinyloxy-8-(1-propan-2-ylpiperidin-4-yl)-5H-pyrido[4,3-b]indol-1-yl]piperidine-3-carboxamide |
| SMILES | CCC1(C(N)=O)CCCN(c2ncc(ONN)c3[nH]c4ccc(C5CCN(C(C)C)CC5)cc4c23)C1 |
| InChI | InChI=1S/C27H39N7O2/c1-4-27(26(28)35)10-5-11-34(16-27)25-23-20-14-19(18-8-12-33(13-9-18)17(2)3)6-7-21(20)31-24(23)22(15-30-25)36-32-29/h6-7,14-15,17-18,31-32H,4-5,8-13,16,29H2,1-3H3,(H2,28,35) |
| InChIKey | LVSNBFDURYNFFV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|