C22H22FN3OS3 — CID 145170870
2-butylsulfanyl-4-[4-(2-fluoroethoxy)phenyl]-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 145170870) has the molecular formula C22H22FN3OS3 and a molecular weight of 459.64 g/mol. Its IUPAC name is 2-butylsulfanyl-4-[4-(2-fluoroethoxy)phenyl]-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-butylsulfanyl-4-[4-(2-fluoroethoxy)phenyl]-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 145170870 |
| Molecular Formula | C22H22FN3OS3 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 2-butylsulfanyl-4-[4-(2-fluoroethoxy)phenyl]-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(OCCF)cc3)c2c1N |
| InChI | InChI=1S/C22H22FN3OS3/c1-2-3-11-29-22-19(24)18-16(14-4-6-15(7-5-14)27-10-8-23)13-17(26-21(18)30-22)20-25-9-12-28-20/h4-7,9,12-13H,2-3,8,10-11,24H2,1H3 |
| InChIKey | XSBCFRWKHSFFTP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|