C25H26ClN5O — CID 145172022
4-[5-[9-(3-chlorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-2-yl]-1,4-dihydropyrimidin-2-yl]morpholine (PubChem CID 145172022) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-[5-[9-(3-chlorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-2-yl]-1,4-dihydropyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[9-(3-chlorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-2-yl]-1,4-dihydropyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 145172022 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[5-[9-(3-chlorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazol-2-yl]-1,4-dihydropyrimidin-2-yl]morpholine |
| SMILES | Clc1cccc(C2CCCc3nc4ccc(C5=CNC(N6CCOCC6)=NC5)cn4c32)c1 |
| InChI | InChI=1S/C25H26ClN5O/c26-20-4-1-3-17(13-20)21-5-2-6-22-24(21)31-16-18(7-8-23(31)29-22)19-14-27-25(28-15-19)30-9-11-32-12-10-30/h1,3-4,7-8,13-14,16,21H,2,5-6,9-12,15H2,(H,27,28) |
| InChIKey | YYVRBHMSWXWUDN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |