About 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol
2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol (PubChem CID 145176619) has the molecular formula C16H22N4O3
and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol.
Molecular Properties
| Compound Name | 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol |
| PubChem CID | 145176619 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol |
| SMILES | CCO.O=[N+]([O-])c1cn(C2CCCCC2)nc1-c1ccccn1 |
| InChI | InChI=1S/C14H16N4O2.C2H6O/c19-18(20)13-10-17(11-6-2-1-3-7-11)16-14(13)12-8-4-5-9-15-12;1-2-3/h4-5,8-11H,1-3,6-7H2;3H,2H2,1H3 |
| InChIKey | NZFKKFVNPZZVSO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol?
The IUPAC name of 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol (CID 145176619) is 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol.
What is the SMILES notation for 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol?
The canonical SMILES for 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol is CCO.O=[N+]([O-])c1cn(C2CCCCC2)nc1-c1ccccn1.
What is the InChIKey of 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol?
The InChIKey is NZFKKFVNPZZVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2.C2H6O/c19-18(20)13-10-17(11-6-2-1-3-7-11)16-14(13)12-8-4-5-9-15-12;1-2-3/h4-5,8-11H,1-3,6-7H2;3H,2H2,1H3.
What are the key properties of 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol?
2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol has a molecular weight of 318.38 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexyl-4-nitropyrazol-3-yl)pyridine;ethanol is sourced from PubChem (CID 145176619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).