C31H50N2O3S — CID 145177526
(4R)-4-[(3R,7R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-pyridin-3-ylsulfanylpentanamide;ethane (PubChem CID 145177526) has the molecular formula C31H50N2O3S and a molecular weight of 530.82 g/mol. Its IUPAC name is (4R)-4-[(3R,7R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-pyridin-3-ylsulfanylpentanamide;ethane.
| Compound Name | (4R)-4-[(3R,7R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-pyridin-3-ylsulfanylpentanamide;ethane |
|---|---|
| PubChem CID | 145177526 |
| Molecular Formula | C31H50N2O3S |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | (4R)-4-[(3R,7R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-pyridin-3-ylsulfanylpentanamide;ethane |
| SMILES | CC.C[C@H](CCC(=O)NSc1cccnc1)C1CCC2C3C(O)CC4C[C@H](O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C29H44N2O3S.C2H6/c1-18(6-9-26(34)31-35-21-5-4-14-30-17-21)22-7-8-23-27-24(11-13-29(22,23)3)28(2)12-10-20(32)15-19(28)16-25(27)33;1-2/h4-5,14,17-20,22-25,27,32-33H,6-13,15-16H2,1-3H3,(H,31,34);1-2H3/t18-,19?,20-,22?,23?,24?,25?,27?,28?,29?;/m1./s1 |
| InChIKey | DUMAKNMVIHRKES-UBCALZAJSA-N |
| XLogP | 6.64 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|