C14H11ClF2N4 — CID 145177684
6-(2-chloro-5-fluoropyrimidin-4-yl)-1-ethyl-4-fluoro-2-methylbenzimidazole (PubChem CID 145177684) has the molecular formula C14H11ClF2N4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 6-(2-chloro-5-fluoropyrimidin-4-yl)-1-ethyl-4-fluoro-2-methylbenzimidazole.
| Compound Name | 6-(2-chloro-5-fluoropyrimidin-4-yl)-1-ethyl-4-fluoro-2-methylbenzimidazole |
|---|---|
| PubChem CID | 145177684 |
| Molecular Formula | C14H11ClF2N4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-(2-chloro-5-fluoropyrimidin-4-yl)-1-ethyl-4-fluoro-2-methylbenzimidazole |
| SMILES | CCn1c(C)nc2c(F)cc(-c3nc(Cl)ncc3F)cc21 |
| InChI | InChI=1S/C14H11ClF2N4/c1-3-21-7(2)19-13-9(16)4-8(5-11(13)21)12-10(17)6-18-14(15)20-12/h4-6H,3H2,1-2H3 |
| InChIKey | WBNVYKVHGVQOBR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |