C17H14ClF2N3O — CID 163381282
2-[6-(2-chloro-5-fluoropyrimidin-4-yl)-8-fluoro-2-methylquinolin-4-yl]propan-2-ol (PubChem CID 163381282) has the molecular formula C17H14ClF2N3O and a molecular weight of 349.77 g/mol. Its IUPAC name is 2-[6-(2-chloro-5-fluoropyrimidin-4-yl)-8-fluoro-2-methylquinolin-4-yl]propan-2-ol.
| Compound Name | 2-[6-(2-chloro-5-fluoropyrimidin-4-yl)-8-fluoro-2-methylquinolin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 163381282 |
| Molecular Formula | C17H14ClF2N3O |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[6-(2-chloro-5-fluoropyrimidin-4-yl)-8-fluoro-2-methylquinolin-4-yl]propan-2-ol |
| SMILES | Cc1cc(C(C)(C)O)c2cc(-c3nc(Cl)ncc3F)cc(F)c2n1 |
| InChI | InChI=1S/C17H14ClF2N3O/c1-8-4-11(17(2,3)24)10-5-9(6-12(19)15(10)22-8)14-13(20)7-21-16(18)23-14/h4-7,24H,1-3H3 |
| InChIKey | YHBGUMACPPZDPU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |