C21H18F3N7O — CID 145179637
4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-yl-2-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 145179637) has the molecular formula C21H18F3N7O and a molecular weight of 441.42 g/mol. Its IUPAC name is 4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-yl-2-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-yl-2-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145179637 |
| Molecular Formula | C21H18F3N7O |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-yl-2-N-(3,4,5-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1cc(Nc2nc(Nc3ccn4ccnc4c3)cc(N3CCOCC3)n2)cc(F)c1F |
| InChI | InChI=1S/C21H18F3N7O/c22-15-9-14(10-16(23)20(15)24)27-21-28-17(12-19(29-21)31-5-7-32-8-6-31)26-13-1-3-30-4-2-25-18(30)11-13/h1-4,9-12H,5-8H2,(H2,26,27,28,29) |
| InChIKey | YUMNDMKUFHOLTG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|