C24H28N8O2 — CID 139450069
2-N-(6-butoxy-3-pyridinyl)-4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 139450069) has the molecular formula C24H28N8O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 2-N-(6-butoxy-3-pyridinyl)-4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(6-butoxy-3-pyridinyl)-4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 139450069 |
| Molecular Formula | C24H28N8O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-N-(6-butoxy-3-pyridinyl)-4-N-imidazo[1,2-a]pyridin-7-yl-6-morpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | CCCCOc1ccc(Nc2nc(Nc3ccn4ccnc4c3)cc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C24H28N8O2/c1-2-3-12-34-23-5-4-19(17-26-23)28-24-29-20(16-22(30-24)32-10-13-33-14-11-32)27-18-6-8-31-9-7-25-21(31)15-18/h4-9,15-17H,2-3,10-14H2,1H3,(H2,27,28,29,30) |
| InChIKey | HKYDSIQIIBJJAM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|