C14H16ClN5O2 — CID 59198392
2-chloro-N-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 59198392) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 2-chloro-N-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 59198392 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-chloro-N-(6-methoxy-3-pyridinyl)-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2cc(N3CCOCC3)nc(Cl)n2)cn1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-21-13-3-2-10(9-16-13)17-11-8-12(19-14(15)18-11)20-4-6-22-7-5-20/h2-3,8-9H,4-7H2,1H3,(H,17,18,19) |
| InChIKey | ILZILYGBJXMQFK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |