C43H34N4 — CID 145179748
N-benzyl-1-(4-fluoranthen-3-ylphenyl)methanimine;N'-methyl-3-pyridin-3-ylbenzenecarboximidamide (PubChem CID 145179748) has the molecular formula C43H34N4 and a molecular weight of 606.77 g/mol. Its IUPAC name is N-benzyl-1-(4-fluoranthen-3-ylphenyl)methanimine;N'-methyl-3-pyridin-3-ylbenzenecarboximidamide.
| Compound Name | N-benzyl-1-(4-fluoranthen-3-ylphenyl)methanimine;N'-methyl-3-pyridin-3-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145179748 |
| Molecular Formula | C43H34N4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | N-benzyl-1-(4-fluoranthen-3-ylphenyl)methanimine;N'-methyl-3-pyridin-3-ylbenzenecarboximidamide |
| SMILES | C(=N/Cc1ccccc1)\c1ccc(-c2ccc3c4c(cccc24)-c2ccccc2-3)cc1.C/N=C(\N)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C30H21N.C13H13N3/c1-2-7-21(8-3-1)19-31-20-22-13-15-23(16-14-22)24-17-18-29-26-10-5-4-9-25(26)28-12-6-11-27(24)30(28)29;1-15-13(14)11-5-2-4-10(8-11)12-6-3-7-16-9-12/h1-18,20H,19H2;2-9H,1H3,(H2,14,15)/b31-20+; |
| InChIKey | KSQUEDORHSMXHM-CVHNRXSESA-N |
| XLogP | 9.86 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|