C56H43N3 — CID 176834786
(Z)-3-benzylimino-1-[4-[4-(7,7-dimethylbenzo[g]fluoren-8-yl)phenyl]naphthalen-1-yl]-3-(3-pyridin-3-ylphenyl)prop-1-en-1-amine (PubChem CID 176834786) has the molecular formula C56H43N3 and a molecular weight of 757.98 g/mol. Its IUPAC name is (Z)-3-benzylimino-1-[4-[4-(7,7-dimethylbenzo[g]fluoren-8-yl)phenyl]naphthalen-1-yl]-3-(3-pyridin-3-ylphenyl)prop-1-en-1-amine.
| Compound Name | (Z)-3-benzylimino-1-[4-[4-(7,7-dimethylbenzo[g]fluoren-8-yl)phenyl]naphthalen-1-yl]-3-(3-pyridin-3-ylphenyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 176834786 |
| Molecular Formula | C56H43N3 |
| Molecular Weight | 757.98 g/mol |
| Exact Mass | 757.35 |
| IUPAC Name | (Z)-3-benzylimino-1-[4-[4-(7,7-dimethylbenzo[g]fluoren-8-yl)phenyl]naphthalen-1-yl]-3-(3-pyridin-3-ylphenyl)prop-1-en-1-amine |
| SMILES | CC1(C)c2ccc3ccccc3c2-c2cccc(-c3ccc(-c4ccc(/C(N)=C/C(=N/Cc5ccccc5)c5cccc(-c6cccnc6)c5)c5ccccc45)cc3)c21 |
| InChI | InChI=1S/C56H43N3/c1-56(2)51-31-28-38-15-6-7-19-45(38)54(51)50-23-11-22-46(55(50)56)40-26-24-39(25-27-40)44-29-30-49(48-21-9-8-20-47(44)48)52(57)34-53(59-35-37-13-4-3-5-14-37)42-17-10-16-41(33-42)43-18-12-32-58-36-43/h3-34,36H,35,57H2,1-2H3/b52-34-,59-53- |
| InChIKey | WVKFCUOVYYDGRR-MEVOSMJVSA-N |
| XLogP | 13.68 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.98 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|