C19H18F2N4O3S2 — CID 145181767
2,5-difluoro-4-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 145181767) has the molecular formula C19H18F2N4O3S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2,5-difluoro-4-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-4-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 145181767 |
| Molecular Formula | C19H18F2N4O3S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2,5-difluoro-4-[(1R)-1-(1,2,3,4-tetrahydroisoquinolin-8-yl)ethoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | C[C@@H](Oc1cc(F)c(S(=O)(=O)Nc2ncns2)cc1F)c1cccc2c1CNCC2 |
| InChI | InChI=1S/C19H18F2N4O3S2/c1-11(13-4-2-3-12-5-6-22-9-14(12)13)28-17-7-16(21)18(8-15(17)20)30(26,27)25-19-23-10-24-29-19/h2-4,7-8,10-11,22H,5-6,9H2,1H3,(H,23,24,25)/t11-/m1/s1 |
| InChIKey | YOYNJNFLCQRVFH-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |