C23H23ClN6O3 — CID 145182692
4-[[(6R)-6-[2-chloro-4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohex-3-ene-1-carbonyl]amino]-1-methylpyrazole-5-carboxamide (PubChem CID 145182692) has the molecular formula C23H23ClN6O3 and a molecular weight of 466.93 g/mol. Its IUPAC name is 4-[[(6R)-6-[2-chloro-4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohex-3-ene-1-carbonyl]amino]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[[(6R)-6-[2-chloro-4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohex-3-ene-1-carbonyl]amino]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 145182692 |
| Molecular Formula | C23H23ClN6O3 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[[(6R)-6-[2-chloro-4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohex-3-ene-1-carbonyl]amino]-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1cc(-c2ccc(C(=O)[C@@H]3CC=CCC3C(=O)Nc3cnn(C)c3C(N)=O)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C23H23ClN6O3/c1-12-9-18(29-28-12)13-7-8-16(17(24)10-13)21(31)14-5-3-4-6-15(14)23(33)27-19-11-26-30(2)20(19)22(25)32/h3-4,7-11,14-15H,5-6H2,1-2H3,(H2,25,32)(H,27,33)(H,28,29)/t14-,15?/m1/s1 |
| InChIKey | CWXMEHRQUUDWCQ-GICMACPYSA-N |
| XLogP | 3.27 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|