C28H38F3N3O2S — CID 145182937
N-[[4-[(Z)-2-(2,6-difluorophenyl)-2-(ethyldiazenyl)ethenyl]cycloheptyl]methyl]-N-ethyl-2-fluorobenzenesulfonamide;ethane (PubChem CID 145182937) has the molecular formula C28H38F3N3O2S and a molecular weight of 537.69 g/mol. Its IUPAC name is N-[[4-[(Z)-2-(2,6-difluorophenyl)-2-(ethyldiazenyl)ethenyl]cycloheptyl]methyl]-N-ethyl-2-fluorobenzenesulfonamide;ethane.
| Compound Name | N-[[4-[(Z)-2-(2,6-difluorophenyl)-2-(ethyldiazenyl)ethenyl]cycloheptyl]methyl]-N-ethyl-2-fluorobenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 145182937 |
| Molecular Formula | C28H38F3N3O2S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[[4-[(Z)-2-(2,6-difluorophenyl)-2-(ethyldiazenyl)ethenyl]cycloheptyl]methyl]-N-ethyl-2-fluorobenzenesulfonamide;ethane |
| SMILES | CC.CC/N=N/C(=C\C1CCCC(CN(CC)S(=O)(=O)c2ccccc2F)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C26H32F3N3O2S.C2H6/c1-3-30-31-24(26-22(28)12-8-13-23(26)29)17-19-9-7-10-20(16-15-19)18-32(4-2)35(33,34)25-14-6-5-11-21(25)27;1-2/h5-6,8,11-14,17,19-20H,3-4,7,9-10,15-16,18H2,1-2H3;1-2H3/b24-17-,31-30+; |
| InChIKey | IBAXZPYGQVMGDA-CHNCCSIRSA-N |
| XLogP | 7.85 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|