C25H29F2N3O4S2 — CID 145182912
N-[[3-[(Z)-2-(2,6-difluorophenyl)-2-(methyldiazenyl)ethenyl]cyclohex-2-en-1-yl]methyl]-N-ethyl-2-methylsulfonylbenzenesulfonamide (PubChem CID 145182912) has the molecular formula C25H29F2N3O4S2 and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[[3-[(Z)-2-(2,6-difluorophenyl)-2-(methyldiazenyl)ethenyl]cyclohex-2-en-1-yl]methyl]-N-ethyl-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[[3-[(Z)-2-(2,6-difluorophenyl)-2-(methyldiazenyl)ethenyl]cyclohex-2-en-1-yl]methyl]-N-ethyl-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 145182912 |
| Molecular Formula | C25H29F2N3O4S2 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N-[[3-[(Z)-2-(2,6-difluorophenyl)-2-(methyldiazenyl)ethenyl]cyclohex-2-en-1-yl]methyl]-N-ethyl-2-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(CC1C=C(/C=C(\N=N\C)c2c(F)cccc2F)CCC1)S(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C25H29F2N3O4S2/c1-4-30(36(33,34)24-14-6-5-13-23(24)35(3,31)32)17-19-10-7-9-18(15-19)16-22(29-28-2)25-20(26)11-8-12-21(25)27/h5-6,8,11-16,19H,4,7,9-10,17H2,1-3H3/b22-16-,29-28+ |
| InChIKey | OSWNXEHYURYASS-MANIDQGKSA-N |
| XLogP | 5.23 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|