C28H35F2N3O2S — CID 134343475
N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethylbenzenesulfonamide (PubChem CID 134343475) has the molecular formula C28H35F2N3O2S and a molecular weight of 515.67 g/mol. Its IUPAC name is N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethylbenzenesulfonamide.
| Compound Name | N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134343475 |
| Molecular Formula | C28H35F2N3O2S |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethylbenzenesulfonamide |
| SMILES | C=C(/C=C(\N=N\C)c1c(F)cccc1F)C1CCC(C)(CN(CC)S(=O)(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C28H35F2N3O2S/c1-7-33(36(34,35)21-12-9-8-10-13-21)19-28(5)17-16-22(27(28,3)4)20(2)18-25(32-31-6)26-23(29)14-11-15-24(26)30/h8-15,18,22H,2,7,16-17,19H2,1,3-6H3/b25-18-,32-31+ |
| InChIKey | KHFXMCCRLYOIHK-GPRVFEJFSA-N |
| XLogP | 7.10 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|