C29H37F2N5O3S — CID 134343351
[4-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl-ethylsulfamoyl]phenyl]urea (PubChem CID 134343351) has the molecular formula C29H37F2N5O3S and a molecular weight of 573.71 g/mol. Its IUPAC name is [4-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl-ethylsulfamoyl]phenyl]urea.
| Compound Name | [4-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl-ethylsulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 134343351 |
| Molecular Formula | C29H37F2N5O3S |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [4-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl-ethylsulfamoyl]phenyl]urea |
| SMILES | C=C(/C=C(\N=N\C)c1c(F)cccc1F)C1CCC(C)(CN(CC)S(=O)(=O)c2ccc(NC(N)=O)cc2)C1(C)C |
| InChI | InChI=1S/C29H37F2N5O3S/c1-7-36(40(38,39)21-13-11-20(12-14-21)34-27(32)37)18-29(5)16-15-22(28(29,3)4)19(2)17-25(35-33-6)26-23(30)9-8-10-24(26)31/h8-14,17,22H,2,7,15-16,18H2,1,3-6H3,(H3,32,34,37)/b25-17-,35-33+ |
| InChIKey | DWJPDYQVHLJEHI-PEJZJCASSA-N |
| XLogP | 6.59 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|