C28H39F2N5O2S — CID 134343401
N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N,1-diethyl-5-methylpyrazole-4-sulfonamide (PubChem CID 134343401) has the molecular formula C28H39F2N5O2S and a molecular weight of 547.72 g/mol. Its IUPAC name is N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N,1-diethyl-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N,1-diethyl-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 134343401 |
| Molecular Formula | C28H39F2N5O2S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | N-[[3-[(3Z)-4-(2,6-difluorophenyl)-4-(methyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methyl]-N,1-diethyl-5-methylpyrazole-4-sulfonamide |
| SMILES | C=C(/C=C(\N=N\C)c1c(F)cccc1F)C1CCC(C)(CN(CC)S(=O)(=O)c2cnn(CC)c2C)C1(C)C |
| InChI | InChI=1S/C28H39F2N5O2S/c1-9-34(38(36,37)25-17-32-35(10-2)20(25)4)18-28(7)15-14-21(27(28,5)6)19(3)16-24(33-31-8)26-22(29)12-11-13-23(26)30/h11-13,16-17,21H,3,9-10,14-15,18H2,1-2,4-8H3/b24-16-,33-31+ |
| InChIKey | RFTUSUIQYPSIJS-IWQLARPQSA-N |
| XLogP | 6.62 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|