C27H35F2N3O — CID 134545698
[(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]-(3,3-dimethylpyrrolidin-1-yl)methanone (PubChem CID 134545698) has the molecular formula C27H35F2N3O and a molecular weight of 455.59 g/mol. Its IUPAC name is [(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]-(3,3-dimethylpyrrolidin-1-yl)methanone.
| Compound Name | [(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]-(3,3-dimethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 134545698 |
| Molecular Formula | C27H35F2N3O |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]-(3,3-dimethylpyrrolidin-1-yl)methanone |
| SMILES | C=C/N=N/C(=C\C(=C)C1CC[C@](C)(C(=O)N2CCC(C)(C)C2)C1(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C27H35F2N3O/c1-8-30-31-22(23-20(28)10-9-11-21(23)29)16-18(2)19-12-13-27(7,26(19,5)6)24(33)32-15-14-25(3,4)17-32/h8-11,16,19H,1-2,12-15,17H2,3-7H3/b22-16-,31-30+/t19?,27-/m1/s1 |
| InChIKey | WUIMCAUNTQUAAN-QRMLMHKRSA-N |
| XLogP | 7.16 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|