C23H29FN8O2 — CID 145187266
methyl (E)-2-[[7-(1-bicyclo[1.1.0]butanyl)-2-[3-fluoro-4-(prop-2-enoylamino)pyrrolidin-1-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]amino]-N-methylpent-2-enimidate (PubChem CID 145187266) has the molecular formula C23H29FN8O2 and a molecular weight of 468.54 g/mol. Its IUPAC name is methyl (E)-2-[[7-(1-bicyclo[1.1.0]butanyl)-2-[3-fluoro-4-(prop-2-enoylamino)pyrrolidin-1-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]amino]-N-methylpent-2-enimidate.
| Compound Name | methyl (E)-2-[[7-(1-bicyclo[1.1.0]butanyl)-2-[3-fluoro-4-(prop-2-enoylamino)pyrrolidin-1-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]amino]-N-methylpent-2-enimidate |
|---|---|
| PubChem CID | 145187266 |
| Molecular Formula | C23H29FN8O2 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | methyl (E)-2-[[7-(1-bicyclo[1.1.0]butanyl)-2-[3-fluoro-4-(prop-2-enoylamino)pyrrolidin-1-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]amino]-N-methylpent-2-enimidate |
| SMILES | C=CC(=O)NC1CN(c2nc(NC(=C/CC)/C(=N/C)OC)c3ncc(C45CC4C5)n3n2)CC1F |
| InChI | InChI=1S/C23H29FN8O2/c1-5-7-15(21(25-3)34-4)28-19-20-26-10-17(23-8-13(23)9-23)32(20)30-22(29-19)31-11-14(24)16(12-31)27-18(33)6-2/h6-7,10,13-14,16H,2,5,8-9,11-12H2,1,3-4H3,(H,27,33)(H,28,29,30)/b15-7+,25-21- |
| InChIKey | IEGKFCXJUJEYJK-NTUOVQQJSA-N |
| XLogP | 2.00 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|