C7H7Cl2N — CID 14518750
2,3-bis(chloromethyl)pyridine (PubChem CID 14518750) has the molecular formula C7H7Cl2N and a molecular weight of 176.05 g/mol. Its IUPAC name is 2,3-bis(chloromethyl)pyridine.
| Compound Name | 2,3-bis(chloromethyl)pyridine |
|---|---|
| PubChem CID | 14518750 |
| Molecular Formula | C7H7Cl2N |
| Molecular Weight | 176.05 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 2,3-bis(chloromethyl)pyridine |
| SMILES | ClCc1cccnc1CCl |
| InChI | InChI=1S/C7H7Cl2N/c8-4-6-2-1-3-10-7(6)5-9/h1-3H,4-5H2 |
| InChIKey | FDHDTLFJPYRSBM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|