C9H17N3 — CID 145187939
5-butanimidoyl-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 145187939) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 5-butanimidoyl-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | 5-butanimidoyl-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 145187939 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 5-butanimidoyl-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | [H]/N=C(\CCC)C1=C(N)CCNC1 |
| InChI | InChI=1S/C9H17N3/c1-2-3-8(10)7-6-12-5-4-9(7)11/h10,12H,2-6,11H2,1H3/b10-8+ |
| InChIKey | SEZDMYQDVYKHJD-CSKARUKUSA-N |
| XLogP | 1.01 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|