About N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate
N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate (PubChem CID 145188437) has the molecular formula C9H15NOS
and a molecular weight of 185.29 g/mol. Its IUPAC name is N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate.
Molecular Properties
| Compound Name | N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate |
| PubChem CID | 145188437 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate |
| SMILES | C=CC1=C(N=C)C(C)CCS1.O |
| InChI | InChI=1S/C9H13NS.H2O/c1-4-8-9(10-3)7(2)5-6-11-8;/h4,7H,1,3,5-6H2,2H3;1H2 |
| InChIKey | QSYIYQSJJBPYNW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate?
The IUPAC name of N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate (CID 145188437) is N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate.
What is the SMILES notation for N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate?
The canonical SMILES for N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate is C=CC1=C(N=C)C(C)CCS1.O.
What is the InChIKey of N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate?
The InChIKey is QSYIYQSJJBPYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.H2O/c1-4-8-9(10-3)7(2)5-6-11-8;/h4,7H,1,3,5-6H2,2H3;1H2.
What are the key properties of N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate?
N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate has a molecular weight of 185.29 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine;hydrate is sourced from PubChem (CID 145188437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).