C9H13NS — CID 145188438
N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine (PubChem CID 145188438) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine.
| Compound Name | N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine |
|---|---|
| PubChem CID | 145188438 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-(6-ethenyl-4-methyl-3,4-dihydro-2H-thiopyran-5-yl)methanimine |
| SMILES | C=CC1=C(N=C)C(C)CCS1 |
| InChI | InChI=1S/C9H13NS/c1-4-8-9(10-3)7(2)5-6-11-8/h4,7H,1,3,5-6H2,2H3 |
| InChIKey | GQNINBYIHMBUJR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|