About S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate
S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate (PubChem CID 145188559) has the molecular formula C11H13FO3S
and a molecular weight of 244.29 g/mol. Its IUPAC name is S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate.
Molecular Properties
| Compound Name | S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate |
| PubChem CID | 145188559 |
| Molecular Formula | C11H13FO3S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate |
| SMILES | O=C(CCCc1cc(F)ccc1O)SCO |
| InChI | InChI=1S/C11H13FO3S/c12-9-4-5-10(14)8(6-9)2-1-3-11(15)16-7-13/h4-6,13-14H,1-3,7H2 |
| InChIKey | UFYUWUUBVKBEDR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate?
The IUPAC name of S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate (CID 145188559) is S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate.
What is the SMILES notation for S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate?
The canonical SMILES for S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate is O=C(CCCc1cc(F)ccc1O)SCO.
What is the InChIKey of S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate?
The InChIKey is UFYUWUUBVKBEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO3S/c12-9-4-5-10(14)8(6-9)2-1-3-11(15)16-7-13/h4-6,13-14H,1-3,7H2.
What are the key properties of S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate?
S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate has a molecular weight of 244.29 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(hydroxymethyl) 4-(5-fluoro-2-hydroxyphenyl)butanethioate is sourced from PubChem (CID 145188559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).