C6H17NS — CID 145190695
N,N-dimethylmethanamine;methylsulfanylethane (PubChem CID 145190695) has the molecular formula C6H17NS and a molecular weight of 135.28 g/mol. Its IUPAC name is N,N-dimethylmethanamine;methylsulfanylethane.
| Compound Name | N,N-dimethylmethanamine;methylsulfanylethane |
|---|---|
| PubChem CID | 145190695 |
| Molecular Formula | C6H17NS |
| Molecular Weight | 135.28 g/mol |
| Exact Mass | 135.11 |
| IUPAC Name | N,N-dimethylmethanamine;methylsulfanylethane |
| SMILES | CCSC.CN(C)C |
| InChI | InChI=1S/C3H9N.C3H8S/c1-4(2)3;1-3-4-2/h1-3H3;3H2,1-2H3 |
| InChIKey | BNFDSSFRJJKMNY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |