C20H17F3N4O3 — CID 145192688
N-[3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 145192688) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is N-[3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 145192688 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[3-(4-ethylimidazol-1-yl)-5-(trifluoromethyl)phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCc1cn(-c2cc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-3-15-10-26(11-24-15)17-8-14(20(21,22)23)7-16(9-17)25-19(28)13-5-4-12(2)18(6-13)27(29)30/h4-11H,3H2,1-2H3,(H,25,28) |
| InChIKey | URECRESMZBLUQM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|