C18H20O3 — CID 145193070
anisole;methyl (E)-3-(3-bicyclo[4.1.0]hepta-2,4-dienyl)prop-2-enoate (PubChem CID 145193070) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is anisole;methyl (E)-3-(3-bicyclo[4.1.0]hepta-2,4-dienyl)prop-2-enoate.
| Compound Name | anisole;methyl (E)-3-(3-bicyclo[4.1.0]hepta-2,4-dienyl)prop-2-enoate |
|---|---|
| PubChem CID | 145193070 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | anisole;methyl (E)-3-(3-bicyclo[4.1.0]hepta-2,4-dienyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CC2CC2C=C1.COc1ccccc1 |
| InChI | InChI=1S/C11H12O2.C7H8O/c1-13-11(12)5-3-8-2-4-9-7-10(9)6-8;1-8-7-5-3-2-4-6-7/h2-6,9-10H,7H2,1H3;2-6H,1H3/b5-3+; |
| InChIKey | GKXMGECZGSREJB-WGCWOXMQSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|