C39H32F3NO3 — CID 145193720
5-(4-methoxyphenyl)-4-(4-pentylphenyl)-6-phenyl-7-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 145193720) has the molecular formula C39H32F3NO3 and a molecular weight of 619.68 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(4-pentylphenyl)-6-phenyl-7-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-methoxyphenyl)-4-(4-pentylphenyl)-6-phenyl-7-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145193720 |
| Molecular Formula | C39H32F3NO3 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(4-pentylphenyl)-6-phenyl-7-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CCCCCc1ccc(-c2c3c(c(-c4ccc(C(F)(F)F)cc4)c(-c4ccccc4)c2-c2ccc(OC)cc2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C39H32F3NO3/c1-3-4-6-9-24-12-14-26(15-13-24)33-32(28-18-22-30(46-2)23-19-28)31(25-10-7-5-8-11-25)34(36-35(33)37(44)43-38(36)45)27-16-20-29(21-17-27)39(40,41)42/h5,7-8,10-23H,3-4,6,9H2,1-2H3,(H,43,44,45) |
| InChIKey | HEASODCMSYMHAX-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|