C33H24F3NO3 — CID 145193725
2-amino-5-(4-methoxyphenyl)-4,6-diphenyl-3-[4-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 145193725) has the molecular formula C33H24F3NO3 and a molecular weight of 539.55 g/mol. Its IUPAC name is 2-amino-5-(4-methoxyphenyl)-4,6-diphenyl-3-[4-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 2-amino-5-(4-methoxyphenyl)-4,6-diphenyl-3-[4-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 145193725 |
| Molecular Formula | C33H24F3NO3 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-amino-5-(4-methoxyphenyl)-4,6-diphenyl-3-[4-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | COc1ccc(-c2c(-c3ccccc3)c(C(=O)O)c(N)c(-c3ccc(C(F)(F)F)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24F3NO3/c1-40-25-18-14-22(15-19-25)26-27(20-8-4-2-5-9-20)29(23-12-16-24(17-13-23)33(34,35)36)31(37)30(32(38)39)28(26)21-10-6-3-7-11-21/h2-19H,37H2,1H3,(H,38,39) |
| InChIKey | WABUGNWCSOFSHV-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|