C41H33NO5 — CID 134924490
[4-amino-3-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone (PubChem CID 134924490) has the molecular formula C41H33NO5 and a molecular weight of 619.72 g/mol. Its IUPAC name is [4-amino-3-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-amino-3-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 134924490 |
| Molecular Formula | C41H33NO5 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | [4-amino-3-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(N)c(-c3ccc(OC)cc3)c(-c3ccccc3)c(C(=O)c3ccc(OC)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H33NO5/c1-45-31-20-14-28(15-21-31)36-34(26-10-6-4-7-11-26)37(40(43)29-16-22-32(46-2)23-17-29)35(27-12-8-5-9-13-27)38(39(36)42)41(44)30-18-24-33(47-3)25-19-30/h4-25H,42H2,1-3H3 |
| InChIKey | USIYSRGOGOCREF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|