C40H30ClNO4 — CID 134924402
[4-amino-3-(4-chlorophenyl)-5-(4-methoxybenzoyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone (PubChem CID 134924402) has the molecular formula C40H30ClNO4 and a molecular weight of 624.14 g/mol. Its IUPAC name is [4-amino-3-(4-chlorophenyl)-5-(4-methoxybenzoyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-amino-3-(4-chlorophenyl)-5-(4-methoxybenzoyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 134924402 |
| Molecular Formula | C40H30ClNO4 |
| Molecular Weight | 624.14 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | [4-amino-3-(4-chlorophenyl)-5-(4-methoxybenzoyl)-2,6-diphenylphenyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(N)c(-c3ccc(Cl)cc3)c(-c3ccccc3)c(C(=O)c3ccc(OC)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H30ClNO4/c1-45-31-21-15-28(16-22-31)39(43)36-33(25-9-5-3-6-10-25)35(27-13-19-30(41)20-14-27)38(42)37(34(36)26-11-7-4-8-12-26)40(44)29-17-23-32(46-2)24-18-29/h3-24H,42H2,1-2H3 |
| InChIKey | JXAJASHFKZOUQV-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.14 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|