C34H23F6NO2 — CID 10461064
[2-amino-3-[3,5-bis(trifluoromethyl)phenyl]-6-(4-methoxyphenyl)-4-phenylphenyl]-phenylmethanone (PubChem CID 10461064) has the molecular formula C34H23F6NO2 and a molecular weight of 591.55 g/mol. Its IUPAC name is [2-amino-3-[3,5-bis(trifluoromethyl)phenyl]-6-(4-methoxyphenyl)-4-phenylphenyl]-phenylmethanone.
| Compound Name | [2-amino-3-[3,5-bis(trifluoromethyl)phenyl]-6-(4-methoxyphenyl)-4-phenylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 10461064 |
| Molecular Formula | C34H23F6NO2 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | [2-amino-3-[3,5-bis(trifluoromethyl)phenyl]-6-(4-methoxyphenyl)-4-phenylphenyl]-phenylmethanone |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(N)c2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H23F6NO2/c1-43-26-14-12-21(13-15-26)28-19-27(20-8-4-2-5-9-20)29(31(41)30(28)32(42)22-10-6-3-7-11-22)23-16-24(33(35,36)37)18-25(17-23)34(38,39)40/h2-19H,41H2,1H3 |
| InChIKey | RGFYTARXUGNLFC-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|