C33H24F3NO2 — CID 10324482
[2-amino-6-(4-methoxyphenyl)-4-phenyl-3-[2-(trifluoromethyl)phenyl]phenyl]-phenylmethanone (PubChem CID 10324482) has the molecular formula C33H24F3NO2 and a molecular weight of 523.55 g/mol. Its IUPAC name is [2-amino-6-(4-methoxyphenyl)-4-phenyl-3-[2-(trifluoromethyl)phenyl]phenyl]-phenylmethanone.
| Compound Name | [2-amino-6-(4-methoxyphenyl)-4-phenyl-3-[2-(trifluoromethyl)phenyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 10324482 |
| Molecular Formula | C33H24F3NO2 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [2-amino-6-(4-methoxyphenyl)-4-phenyl-3-[2-(trifluoromethyl)phenyl]phenyl]-phenylmethanone |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3C(F)(F)F)c(N)c2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24F3NO2/c1-39-24-18-16-22(17-19-24)27-20-26(21-10-4-2-5-11-21)29(25-14-8-9-15-28(25)33(34,35)36)31(37)30(27)32(38)23-12-6-3-7-13-23/h2-20H,37H2,1H3 |
| InChIKey | ALBQNHNYEVITBV-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|