C39H27Cl2NO3 — CID 134924404
[4-amino-3-(4-chlorobenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-chlorophenyl)methanone (PubChem CID 134924404) has the molecular formula C39H27Cl2NO3 and a molecular weight of 628.56 g/mol. Its IUPAC name is [4-amino-3-(4-chlorobenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-chlorophenyl)methanone.
| Compound Name | [4-amino-3-(4-chlorobenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 134924404 |
| Molecular Formula | C39H27Cl2NO3 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | [4-amino-3-(4-chlorobenzoyl)-5-(4-methoxyphenyl)-2,6-diphenylphenyl]-(4-chlorophenyl)methanone |
| SMILES | COc1ccc(-c2c(N)c(C(=O)c3ccc(Cl)cc3)c(-c3ccccc3)c(C(=O)c3ccc(Cl)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H27Cl2NO3/c1-45-31-22-16-26(17-23-31)34-32(24-8-4-2-5-9-24)35(38(43)27-12-18-29(40)19-13-27)33(25-10-6-3-7-11-25)36(37(34)42)39(44)28-14-20-30(41)21-15-28/h2-23H,42H2,1H3 |
| InChIKey | WCZMALRPUGGYKW-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|