C28H18ClN3O2 — CID 139203800
2-amino-4-benzoyl-6-(4-chlorophenyl)-5-(4-methoxyphenyl)benzene-1,3-dicarbonitrile (PubChem CID 139203800) has the molecular formula C28H18ClN3O2 and a molecular weight of 463.92 g/mol. Its IUPAC name is 2-amino-4-benzoyl-6-(4-chlorophenyl)-5-(4-methoxyphenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-benzoyl-6-(4-chlorophenyl)-5-(4-methoxyphenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139203800 |
| Molecular Formula | C28H18ClN3O2 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-amino-4-benzoyl-6-(4-chlorophenyl)-5-(4-methoxyphenyl)benzene-1,3-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C(=O)c3ccccc3)c(C#N)c(N)c(C#N)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H18ClN3O2/c1-34-21-13-9-18(10-14-21)25-24(17-7-11-20(29)12-8-17)22(15-30)27(32)23(16-31)26(25)28(33)19-5-3-2-4-6-19/h2-14H,32H2,1H3 |
| InChIKey | PABADWDGSXUYTF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|