C29H26Cl2N6O4 — CID 145194074
(E)-2-cyano-N-[3-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]but-2-enamide (PubChem CID 145194074) has the molecular formula C29H26Cl2N6O4 and a molecular weight of 593.47 g/mol. Its IUPAC name is (E)-2-cyano-N-[3-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]but-2-enamide.
| Compound Name | (E)-2-cyano-N-[3-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 145194074 |
| Molecular Formula | C29H26Cl2N6O4 |
| Molecular Weight | 593.47 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | (E)-2-cyano-N-[3-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]but-2-enamide |
| SMILES | C/C=C(\C#N)C(=O)Nc1cccc(CCn2c(=O)c(-c3c(Cl)c(OC)cc(OC)c3Cl)cc3cnc(NC)nc32)c1 |
| InChI | InChI=1S/C29H26Cl2N6O4/c1-5-17(14-32)27(38)35-19-8-6-7-16(11-19)9-10-37-26-18(15-34-29(33-2)36-26)12-20(28(37)39)23-24(30)21(40-3)13-22(41-4)25(23)31/h5-8,11-13,15H,9-10H2,1-4H3,(H,35,38)(H,33,34,36)/b17-5+ |
| InChIKey | DRJQGAYXFYRTCP-YAXRCOADSA-N |
| XLogP | 5.48 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|