C31H37Cl2N7O4 — CID 153313364
2-cyano-N-[1-[3-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]propyl]pyrrolidin-3-yl]-4,4-dimethylpent-2-enamide (PubChem CID 153313364) has the molecular formula C31H37Cl2N7O4 and a molecular weight of 642.59 g/mol. Its IUPAC name is 2-cyano-N-[1-[3-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]propyl]pyrrolidin-3-yl]-4,4-dimethylpent-2-enamide.
| Compound Name | 2-cyano-N-[1-[3-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]propyl]pyrrolidin-3-yl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 153313364 |
| Molecular Formula | C31H37Cl2N7O4 |
| Molecular Weight | 642.59 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | 2-cyano-N-[1-[3-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylamino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]propyl]pyrrolidin-3-yl]-4,4-dimethylpent-2-enamide |
| SMILES | CNc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c(=O)n(CCCN3CCC(NC(=O)C(C#N)=CC(C)(C)C)C3)c2n1 |
| InChI | InChI=1S/C31H37Cl2N7O4/c1-31(2,3)14-19(15-34)28(41)37-20-8-11-39(17-20)9-7-10-40-27-18(16-36-30(35-4)38-27)12-21(29(40)42)24-25(32)22(43-5)13-23(44-6)26(24)33/h12-14,16,20H,7-11,17H2,1-6H3,(H,37,41)(H,35,36,38) |
| InChIKey | NCOUTBPXZLNXKG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|