C28H45N3 — CID 145194689
1-N'-[(1E,4E)-1-[(E)-1-(5-tert-butylcyclohepta-1,6-dien-1-yl)ethylideneamino]-4-methylhepta-1,4-dienyl]-1-N'-ethenyl-1-N-propylethene-1,1-diamine (PubChem CID 145194689) has the molecular formula C28H45N3 and a molecular weight of 423.69 g/mol. Its IUPAC name is 1-N'-[(1E,4E)-1-[(E)-1-(5-tert-butylcyclohepta-1,6-dien-1-yl)ethylideneamino]-4-methylhepta-1,4-dienyl]-1-N'-ethenyl-1-N-propylethene-1,1-diamine.
| Compound Name | 1-N'-[(1E,4E)-1-[(E)-1-(5-tert-butylcyclohepta-1,6-dien-1-yl)ethylideneamino]-4-methylhepta-1,4-dienyl]-1-N'-ethenyl-1-N-propylethene-1,1-diamine |
|---|---|
| PubChem CID | 145194689 |
| Molecular Formula | C28H45N3 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | 1-N'-[(1E,4E)-1-[(E)-1-(5-tert-butylcyclohepta-1,6-dien-1-yl)ethylideneamino]-4-methylhepta-1,4-dienyl]-1-N'-ethenyl-1-N-propylethene-1,1-diamine |
| SMILES | C=CN(C(=C)NCCC)C(=C/C/C(C)=C/CC)/N=C(\C)C1=CCCC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C28H45N3/c1-10-14-22(4)17-20-27(31(12-3)24(6)29-21-11-2)30-23(5)25-15-13-16-26(19-18-25)28(7,8)9/h12,14-15,18-20,26,29H,3,6,10-11,13,16-17,21H2,1-2,4-5,7-9H3/b22-14+,27-20+,30-23+ |
| InChIKey | UIJUGELJEFEZOJ-CEXHOMGXSA-N |
| XLogP | 7.89 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|