C22H28ClFN2O2 — CID 145194818
2-[3-(4-chloro-3-methylanilino)-2-fluoropropyl]isoindole-1,3-dione;ethane (PubChem CID 145194818) has the molecular formula C22H28ClFN2O2 and a molecular weight of 406.93 g/mol. Its IUPAC name is 2-[3-(4-chloro-3-methylanilino)-2-fluoropropyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[3-(4-chloro-3-methylanilino)-2-fluoropropyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 145194818 |
| Molecular Formula | C22H28ClFN2O2 |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[3-(4-chloro-3-methylanilino)-2-fluoropropyl]isoindole-1,3-dione;ethane |
| SMILES | CC.CC.Cc1cc(NCC(F)CN2C(=O)c3ccccc3C2=O)ccc1Cl |
| InChI | InChI=1S/C18H16ClFN2O2.2C2H6/c1-11-8-13(6-7-16(11)19)21-9-12(20)10-22-17(23)14-4-2-3-5-15(14)18(22)24;2*1-2/h2-8,12,21H,9-10H2,1H3;2*1-2H3 |
| InChIKey | QPSMFWNIKTXTGX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|