C18H23NO2 — CID 145196011
(1R)-6-aminooxy-1-methyl-7-propan-2-yl-2,3,4,4a-tetrahydro-1H-phenanthren-9-one (PubChem CID 145196011) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1R)-6-aminooxy-1-methyl-7-propan-2-yl-2,3,4,4a-tetrahydro-1H-phenanthren-9-one.
| Compound Name | (1R)-6-aminooxy-1-methyl-7-propan-2-yl-2,3,4,4a-tetrahydro-1H-phenanthren-9-one |
|---|---|
| PubChem CID | 145196011 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1R)-6-aminooxy-1-methyl-7-propan-2-yl-2,3,4,4a-tetrahydro-1H-phenanthren-9-one |
| SMILES | CC(C)c1cc2c(cc1ON)C1CCC[C@@H](C)C1=CC2=O |
| InChI | InChI=1S/C18H23NO2/c1-10(2)13-7-16-15(9-18(13)21-19)12-6-4-5-11(3)14(12)8-17(16)20/h7-12H,4-6,19H2,1-3H3/t11-,12?/m1/s1 |
| InChIKey | IBXRTXNFVPELHX-JHJMLUEUSA-N |
| XLogP | 4.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|