C19H28N2O2 — CID 145196382
1-azabicyclo[2.2.2]octane;4-phenylpiperidine-4-carboxylic acid (PubChem CID 145196382) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-azabicyclo[2.2.2]octane;4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 145196382 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;4-phenylpiperidine-4-carboxylic acid |
| SMILES | C1CN2CCC1CC2.O=C(O)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C12H15NO2.C7H13N/c14-11(15)12(6-8-13-9-7-12)10-4-2-1-3-5-10;1-4-8-5-2-7(1)3-6-8/h1-5,13H,6-9H2,(H,14,15);7H,1-6H2 |
| InChIKey | RRBHVBZSXHMLEF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |