C27H27Cl2FNO4S+ — CID 145196885
[4-[2-[4-[4-(2,4-dichlorophenyl)oxan-4-yl]oxy-3-fluoroanilino]-2-oxoethyl]phenyl]-ethyl-hydroxysulfanium (PubChem CID 145196885) has the molecular formula C27H27Cl2FNO4S+ and a molecular weight of 551.49 g/mol. Its IUPAC name is [4-[2-[4-[4-(2,4-dichlorophenyl)oxan-4-yl]oxy-3-fluoroanilino]-2-oxoethyl]phenyl]-ethyl-hydroxysulfanium.
| Compound Name | [4-[2-[4-[4-(2,4-dichlorophenyl)oxan-4-yl]oxy-3-fluoroanilino]-2-oxoethyl]phenyl]-ethyl-hydroxysulfanium |
|---|---|
| PubChem CID | 145196885 |
| Molecular Formula | C27H27Cl2FNO4S+ |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | [4-[2-[4-[4-(2,4-dichlorophenyl)oxan-4-yl]oxy-3-fluoroanilino]-2-oxoethyl]phenyl]-ethyl-hydroxysulfanium |
| SMILES | CC[S+](O)c1ccc(CC(=O)Nc2ccc(OC3(c4ccc(Cl)cc4Cl)CCOCC3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H26Cl2FNO4S/c1-2-36(33)21-7-3-18(4-8-21)15-26(32)31-20-6-10-25(24(30)17-20)35-27(11-13-34-14-12-27)22-9-5-19(28)16-23(22)29/h3-10,16-17,33H,2,11-15H2,1H3/p+1 |
| InChIKey | JCBGPMCUTBDHEG-UHFFFAOYSA-O |
| XLogP | 6.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|