C14H27N3 — CID 145197608
(1E,3Z)-1-(5-azaspiro[2.5]octan-5-yl)penta-1,3-diene-1,4-diamine;ethane (PubChem CID 145197608) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (1E,3Z)-1-(5-azaspiro[2.5]octan-5-yl)penta-1,3-diene-1,4-diamine;ethane.
| Compound Name | (1E,3Z)-1-(5-azaspiro[2.5]octan-5-yl)penta-1,3-diene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 145197608 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (1E,3Z)-1-(5-azaspiro[2.5]octan-5-yl)penta-1,3-diene-1,4-diamine;ethane |
| SMILES | C/C(N)=C/C=C(\N)N1CCCC2(CC2)C1.CC |
| InChI | InChI=1S/C12H21N3.C2H6/c1-10(13)3-4-11(14)15-8-2-5-12(9-15)6-7-12;1-2/h3-4H,2,5-9,13-14H2,1H3;1-2H3/b10-3-,11-4+; |
| InChIKey | HQUBAHCOLGMKIO-UNWOOLTNSA-N |
| XLogP | 2.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|