C13H25N3 — CID 134406583
(1E,3Z)-1-(3-propylpiperidin-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 134406583) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is (1E,3Z)-1-(3-propylpiperidin-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(3-propylpiperidin-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406583 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | (1E,3Z)-1-(3-propylpiperidin-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | CCCC1CCCN(/C(N)=C/C=C(/C)N)C1 |
| InChI | InChI=1S/C13H25N3/c1-3-5-12-6-4-9-16(10-12)13(15)8-7-11(2)14/h7-8,12H,3-6,9-10,14-15H2,1-2H3/b11-7-,13-8+ |
| InChIKey | TVGRGCPVJQWLDO-JKNYEHFOSA-N |
| XLogP | 2.16 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|