C13H25N3O — CID 145197681
2-amino-N-methyl-N-(3-prop-1-en-2-yliminoprop-1-en-2-yl)butanamide;ethane (PubChem CID 145197681) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(3-prop-1-en-2-yliminoprop-1-en-2-yl)butanamide;ethane.
| Compound Name | 2-amino-N-methyl-N-(3-prop-1-en-2-yliminoprop-1-en-2-yl)butanamide;ethane |
|---|---|
| PubChem CID | 145197681 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-amino-N-methyl-N-(3-prop-1-en-2-yliminoprop-1-en-2-yl)butanamide;ethane |
| SMILES | C=C(C)/N=C/C(=C)N(C)C(=O)C(N)CC.CC |
| InChI | InChI=1S/C11H19N3O.C2H6/c1-6-10(12)11(15)14(5)9(4)7-13-8(2)3;1-2/h7,10H,2,4,6,12H2,1,3,5H3;1-2H3/b13-7+; |
| InChIKey | ZKGRWWUBASIIBE-FTPOTTDRSA-N |
| XLogP | 2.33 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|