C14H25N3 — CID 145198174
ethane;2-methyl-6-(piperazin-1-ylmethyl)-4H-azepine (PubChem CID 145198174) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is ethane;2-methyl-6-(piperazin-1-ylmethyl)-4H-azepine.
| Compound Name | ethane;2-methyl-6-(piperazin-1-ylmethyl)-4H-azepine |
|---|---|
| PubChem CID | 145198174 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | ethane;2-methyl-6-(piperazin-1-ylmethyl)-4H-azepine |
| SMILES | CC.CC1=CCC=C(CN2CCNCC2)C=N1 |
| InChI | InChI=1S/C12H19N3.C2H6/c1-11-3-2-4-12(9-14-11)10-15-7-5-13-6-8-15;1-2/h3-4,9,13H,2,5-8,10H2,1H3;1-2H3 |
| InChIKey | FTJRYENLRTXICH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |