C17H34N2 — CID 145198223
ethane;(2Z,4E)-N-methyl-2-(piperidin-1-ylmethyl)hexa-2,4-dien-1-imine (PubChem CID 145198223) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;(2Z,4E)-N-methyl-2-(piperidin-1-ylmethyl)hexa-2,4-dien-1-imine.
| Compound Name | ethane;(2Z,4E)-N-methyl-2-(piperidin-1-ylmethyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145198223 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;(2Z,4E)-N-methyl-2-(piperidin-1-ylmethyl)hexa-2,4-dien-1-imine |
| SMILES | C/C=C/C=C(\C=N\C)CN1CCCCC1.CC.CC |
| InChI | InChI=1S/C13H22N2.2C2H6/c1-3-4-8-13(11-14-2)12-15-9-6-5-7-10-15;2*1-2/h3-4,8,11H,5-7,9-10,12H2,1-2H3;2*1-2H3/b4-3+,13-8+,14-11+;; |
| InChIKey | FBTMWYHOMWIGAL-RVOQHDGFSA-N |
| XLogP | 4.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|